C20H32 — CID 14380754
(1R,3R,4R,7S,8Z,12S)-1,4,8-trimethyl-12-prop-1-en-2-yltricyclo[9.3.0.03,7]tetradec-8-ene (PubChem CID 14380754) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1R,3R,4R,7S,8Z,12S)-1,4,8-trimethyl-12-prop-1-en-2-yltricyclo[9.3.0.03,7]tetradec-8-ene.
| Compound Name | (1R,3R,4R,7S,8Z,12S)-1,4,8-trimethyl-12-prop-1-en-2-yltricyclo[9.3.0.03,7]tetradec-8-ene |
|---|---|
| PubChem CID | 14380754 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1R,3R,4R,7S,8Z,12S)-1,4,8-trimethyl-12-prop-1-en-2-yltricyclo[9.3.0.03,7]tetradec-8-ene |
| SMILES | C=C(C)[C@H]1CC[C@]2(C)C[C@@H]3[C@H](C)CC[C@@H]3/C(C)=C\CC12 |
| InChI | InChI=1S/C20H32/c1-13(2)16-10-11-20(5)12-18-15(4)6-8-17(18)14(3)7-9-19(16)20/h7,15-19H,1,6,8-12H2,2-5H3/b14-7-/t15-,16-,17-,18-,19?,20-/m1/s1 |
| InChIKey | QZVJAIKGBMBQTR-QIHNCSAQSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|