About 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile
4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile (PubChem CID 143808997) has the molecular formula C8H6F3N2O-
and a molecular weight of 203.14 g/mol. Its IUPAC name is 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile.
Molecular Properties
| Compound Name | 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile |
| PubChem CID | 143808997 |
| Molecular Formula | C8H6F3N2O- |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile |
| SMILES | N#CC1C=C(C(O)C(F)(F)F)C=C[N-]1 |
| InChI | InChI=1S/C8H6F3N2O/c9-8(10,11)7(14)5-1-2-13-6(3-5)4-12/h1-3,6-7,14H/q-1 |
| InChIKey | YHBPIDZRTZQTPI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile?
The IUPAC name of 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile (CID 143808997) is 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile.
What is the SMILES notation for 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile?
The canonical SMILES for 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile is N#CC1C=C(C(O)C(F)(F)F)C=C[N-]1.
What is the InChIKey of 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile?
The InChIKey is YHBPIDZRTZQTPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3N2O/c9-8(10,11)7(14)5-1-2-13-6(3-5)4-12/h1-3,6-7,14H/q-1.
What are the key properties of 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile?
4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile has a molecular weight of 203.14 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,2-trifluoro-1-hydroxyethyl)-2H-pyridin-1-ide-2-carbonitrile is sourced from PubChem (CID 143808997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).