C65H70BrN — CID 143809636
N-(4-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-N-[4-[2-ethyl-4-[4-[3-ethyl-4-(4-methylphenyl)phenyl]-2,5-dihexylphenyl]phenyl]phenyl]aniline (PubChem CID 143809636) has the molecular formula C65H70BrN and a molecular weight of 945.19 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-N-[4-[2-ethyl-4-[4-[3-ethyl-4-(4-methylphenyl)phenyl]-2,5-dihexylphenyl]phenyl]phenyl]aniline.
| Compound Name | N-(4-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-N-[4-[2-ethyl-4-[4-[3-ethyl-4-(4-methylphenyl)phenyl]-2,5-dihexylphenyl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 143809636 |
| Molecular Formula | C65H70BrN |
| Molecular Weight | 945.19 g/mol |
| Exact Mass | 943.47 |
| IUPAC Name | N-(4-bromophenyl)-4-cyclohexa-1,5-dien-1-yl-N-[4-[2-ethyl-4-[4-[3-ethyl-4-(4-methylphenyl)phenyl]-2,5-dihexylphenyl]phenyl]phenyl]aniline |
| SMILES | CCCCCCc1cc(-c2ccc(-c3ccc(N(c4ccc(Br)cc4)c4ccc(C5=CCCC=C5)cc4)cc3)c(CC)c2)c(CCCCCC)cc1-c1ccc(-c2ccc(C)cc2)c(CC)c1 |
| InChI | InChI=1S/C65H70BrN/c1-6-10-12-15-21-54-46-65(55(22-16-13-11-7-2)45-64(54)56-31-41-62(48(8-3)43-56)52-25-23-47(5)24-26-52)57-32-42-63(49(9-4)44-57)53-29-37-60(38-30-53)67(61-39-33-58(66)34-40-61)59-35-27-51(28-36-59)50-19-17-14-18-20-50/h17,19-20,23-46H,6-16,18,21-22H2,1-5H3 |
| InChIKey | HNWHGHNWPSOCKP-UHFFFAOYSA-N |
| XLogP | 20.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.19 |
| LogP ≤ 5 | 20.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|