About ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane
ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane (PubChem CID 143810158) has the molecular formula C22H32FNOS
and a molecular weight of 377.57 g/mol. Its IUPAC name is ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane.
Molecular Properties
| Compound Name | ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane |
| PubChem CID | 143810158 |
| Molecular Formula | C22H32FNOS |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane |
| SMILES | C.CC.CNc1cccc(-c2c(OC)ccc(CC3CCCS3)c2F)c1 |
| InChI | InChI=1S/C19H22FNOS.C2H6.CH4/c1-21-15-6-3-5-13(11-15)18-17(22-2)9-8-14(19(18)20)12-16-7-4-10-23-16;1-2;/h3,5-6,8-9,11,16,21H,4,7,10,12H2,1-2H3;1-2H3;1H4 |
| InChIKey | BUQONVSBOCSENG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane?
The IUPAC name of ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane (CID 143810158) is ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane.
What is the SMILES notation for ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane?
The canonical SMILES for ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane is C.CC.CNc1cccc(-c2c(OC)ccc(CC3CCCS3)c2F)c1.
What is the InChIKey of ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane?
The InChIKey is BUQONVSBOCSENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNOS.C2H6.CH4/c1-21-15-6-3-5-13(11-15)18-17(22-2)9-8-14(19(18)20)12-16-7-4-10-23-16;1-2;/h3,5-6,8-9,11,16,21H,4,7,10,12H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane?
ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane has a molecular weight of 377.57 g/mol, XLogP of 6.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[2-fluoro-6-methoxy-3-(thiolan-2-ylmethyl)phenyl]-N-methylaniline;methane is sourced from PubChem (CID 143810158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).