About (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine
(1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine (PubChem CID 143810281) has the molecular formula C7H12FN
and a molecular weight of 129.18 g/mol. Its IUPAC name is (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine |
| PubChem CID | 143810281 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine |
| SMILES | CN/C(F)=C\C=C(C)C |
| InChI | InChI=1S/C7H12FN/c1-6(2)4-5-7(8)9-3/h4-5,9H,1-3H3/b7-5- |
| InChIKey | UZIHGOZETVREQV-ALCCZGGFSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine?
The IUPAC name of (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine (CID 143810281) is (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine?
The canonical SMILES for (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine is CN/C(F)=C\C=C(C)C.
What is the InChIKey of (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine?
The InChIKey is UZIHGOZETVREQV-ALCCZGGFSA-N. The full InChI is InChI=1S/C7H12FN/c1-6(2)4-5-7(8)9-3/h4-5,9H,1-3H3/b7-5-.
What are the key properties of (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine?
(1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine has a molecular weight of 129.18 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-fluoro-N,4-dimethylpenta-1,3-dien-1-amine is sourced from PubChem (CID 143810281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).