C33H30N2O4S3 — CID 143810647
(2S)-2-[(5Z)-5-[(5-methyl-4-phenylcyclohexa-1,3-dien-1-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide (PubChem CID 143810647) has the molecular formula C33H30N2O4S3 and a molecular weight of 614.81 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[(5-methyl-4-phenylcyclohexa-1,3-dien-1-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(5Z)-5-[(5-methyl-4-phenylcyclohexa-1,3-dien-1-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 143810647 |
| Molecular Formula | C33H30N2O4S3 |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | (2S)-2-[(5Z)-5-[(5-methyl-4-phenylcyclohexa-1,3-dien-1-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-methylphenyl)sulfonyl-3-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)[C@H](Cc2ccccc2)N2C(=O)/C(=C/C3=CC=C(c4ccccc4)C(C)C3)SC2=S)cc1 |
| InChI | InChI=1S/C33H30N2O4S3/c1-22-13-16-27(17-14-22)42(38,39)34-31(36)29(20-24-9-5-3-6-10-24)35-32(37)30(41-33(35)40)21-25-15-18-28(23(2)19-25)26-11-7-4-8-12-26/h3-18,21,23,29H,19-20H2,1-2H3,(H,34,36)/b30-21-/t23?,29-/m0/s1 |
| InChIKey | LSQNVFZIMKBXTG-TZNZNGOISA-N |
| XLogP | 6.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|