About (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane
(2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane (PubChem CID 143810811) has the molecular formula C18H17BrF3N
and a molecular weight of 384.24 g/mol. Its IUPAC name is (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane.
Molecular Properties
| Compound Name | (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane |
| PubChem CID | 143810811 |
| Molecular Formula | C18H17BrF3N |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane |
| SMILES | CC.Fc1cc(Br)ccc1[C@H]1CCC(c2c(F)cccc2F)=N1 |
| InChI | InChI=1S/C16H11BrF3N.C2H6/c17-9-4-5-10(13(20)8-9)14-6-7-15(21-14)16-11(18)2-1-3-12(16)19;1-2/h1-5,8,14H,6-7H2;1-2H3/t14-;/m1./s1 |
| InChIKey | CWOZTRCCMNNVNA-PFEQFJNWSA-N |
| XLogP | 6.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane?
The IUPAC name of (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane (CID 143810811) is (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane.
What is the SMILES notation for (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane?
The canonical SMILES for (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane is CC.Fc1cc(Br)ccc1[C@H]1CCC(c2c(F)cccc2F)=N1.
What is the InChIKey of (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane?
The InChIKey is CWOZTRCCMNNVNA-PFEQFJNWSA-N. The full InChI is InChI=1S/C16H11BrF3N.C2H6/c17-9-4-5-10(13(20)8-9)14-6-7-15(21-14)16-11(18)2-1-3-12(16)19;1-2/h1-5,8,14H,6-7H2;1-2H3/t14-;/m1./s1.
What are the key properties of (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane?
(2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane has a molecular weight of 384.24 g/mol, XLogP of 6.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-bromo-2-fluorophenyl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole;ethane is sourced from PubChem (CID 143810811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).