C21H26F3N3O4 — CID 143810918
methyl N-ethenyl-1-(morpholine-4-carbonyl)-5-[4-(trifluoromethoxy)phenyl]piperidine-3-carboximidate (PubChem CID 143810918) has the molecular formula C21H26F3N3O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is methyl N-ethenyl-1-(morpholine-4-carbonyl)-5-[4-(trifluoromethoxy)phenyl]piperidine-3-carboximidate.
| Compound Name | methyl N-ethenyl-1-(morpholine-4-carbonyl)-5-[4-(trifluoromethoxy)phenyl]piperidine-3-carboximidate |
|---|---|
| PubChem CID | 143810918 |
| Molecular Formula | C21H26F3N3O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | methyl N-ethenyl-1-(morpholine-4-carbonyl)-5-[4-(trifluoromethoxy)phenyl]piperidine-3-carboximidate |
| SMILES | C=C/N=C(\OC)C1CC(c2ccc(OC(F)(F)F)cc2)CN(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C21H26F3N3O4/c1-3-25-19(29-2)17-12-16(15-4-6-18(7-5-15)31-21(22,23)24)13-27(14-17)20(28)26-8-10-30-11-9-26/h3-7,16-17H,1,8-14H2,2H3/b25-19- |
| InChIKey | CPYBTWSKIPSPIH-PLRJNAJWSA-N |
| XLogP | 3.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|