About cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen
cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen (PubChem CID 143811336) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen |
| PubChem CID | 143811336 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen |
| SMILES | CCCNC(=O)OCC1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C11H17NO2.H2/c1-2-8-12-11(13)14-9-10-6-4-3-5-7-10;/h4,6-7H,2-3,5,8-9H2,1H3,(H,12,13);1H |
| InChIKey | SDLYHXXWMSXVKD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen (CID 143811336) is cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen is CCCNC(=O)OCC1=CCCC=C1.[H][H].
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen?
The InChIKey is SDLYHXXWMSXVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2.H2/c1-2-8-12-11(13)14-9-10-6-4-3-5-7-10;/h4,6-7H,2-3,5,8-9H2,1H3,(H,12,13);1H.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen?
cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen has a molecular weight of 197.28 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl N-propylcarbamate;molecular hydrogen is sourced from PubChem (CID 143811336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).