About N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane
N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane (PubChem CID 143811544) has the molecular formula C15H27N3O2
and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane.
Molecular Properties
| Compound Name | N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane |
| PubChem CID | 143811544 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane |
| SMILES | CC.COc1cnc(CNC2CCNCC2)cc1OC |
| InChI | InChI=1S/C13H21N3O2.C2H6/c1-17-12-7-11(16-9-13(12)18-2)8-15-10-3-5-14-6-4-10;1-2/h7,9-10,14-15H,3-6,8H2,1-2H3;1-2H3 |
| InChIKey | VGZJZMAZUOJUMT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane?
The IUPAC name of N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane (CID 143811544) is N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane.
What is the SMILES notation for N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane?
The canonical SMILES for N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane is CC.COc1cnc(CNC2CCNCC2)cc1OC.
What is the InChIKey of N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane?
The InChIKey is VGZJZMAZUOJUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2.C2H6/c1-17-12-7-11(16-9-13(12)18-2)8-15-10-3-5-14-6-4-10;1-2/h7,9-10,14-15H,3-6,8H2,1-2H3;1-2H3.
What are the key properties of N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane?
N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane has a molecular weight of 281.40 g/mol, XLogP of 1.97, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,5-dimethoxy-2-pyridinyl)methyl]piperidin-4-amine;ethane is sourced from PubChem (CID 143811544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).