About 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine
3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine (PubChem CID 143811751) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine.
Molecular Properties
| Compound Name | 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine |
| PubChem CID | 143811751 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine |
| SMILES | C=C(C(C)Oc1ccc2c(c1)=CCCC=2)N(C)CCC |
| InChI | InChI=1S/C18H25NO/c1-5-12-19(4)14(2)15(3)20-18-11-10-16-8-6-7-9-17(16)13-18/h8-11,13,15H,2,5-7,12H2,1,3-4H3 |
| InChIKey | LCRCFQCKDLPZCM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine?
The IUPAC name of 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine (CID 143811751) is 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine.
What is the SMILES notation for 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine?
The canonical SMILES for 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine is C=C(C(C)Oc1ccc2c(c1)=CCCC=2)N(C)CCC.
What is the InChIKey of 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine?
The InChIKey is LCRCFQCKDLPZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO/c1-5-12-19(4)14(2)15(3)20-18-11-10-16-8-6-7-9-17(16)13-18/h8-11,13,15H,2,5-7,12H2,1,3-4H3.
What are the key properties of 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine?
3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine has a molecular weight of 271.40 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dihydronaphthalen-2-yloxy)-N-methyl-N-propylbut-1-en-2-amine is sourced from PubChem (CID 143811751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).