C23H25Cl2FN3O+ — CID 143811970
[(2R)-3-(4-cyanophenyl)-1-(3,5-dichloro-4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]azanium;(3Z)-2-methylpenta-1,3-diene (PubChem CID 143811970) has the molecular formula C23H25Cl2FN3O+ and a molecular weight of 449.38 g/mol. Its IUPAC name is [(2R)-3-(4-cyanophenyl)-1-(3,5-dichloro-4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]azanium;(3Z)-2-methylpenta-1,3-diene.
| Compound Name | [(2R)-3-(4-cyanophenyl)-1-(3,5-dichloro-4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]azanium;(3Z)-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 143811970 |
| Molecular Formula | C23H25Cl2FN3O+ |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [(2R)-3-(4-cyanophenyl)-1-(3,5-dichloro-4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]azanium;(3Z)-2-methylpenta-1,3-diene |
| SMILES | C=C(C)/C=C\C.C[C@@]([NH3+])(Cc1ccc(C#N)cc1)C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2FN3O.C6H10/c1-17(22,8-10-2-4-11(9-21)5-3-10)16(24)23-12-6-13(18)15(20)14(19)7-12;1-4-5-6(2)3/h2-7H,8,22H2,1H3,(H,23,24);4-5H,2H2,1,3H3/p+1/b;5-4-/t17-;/m1./s1 |
| InChIKey | MWWVQGSZSYEQHJ-LKVVIWFNSA-O |
| XLogP | 5.32 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|