About N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane
N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane (PubChem CID 143812055) has the molecular formula C12H21N3O2S
and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane.
Molecular Properties
| Compound Name | N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane |
| PubChem CID | 143812055 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane |
| SMILES | COC.CS(=O)NCc1ccc(C2(N)CC2)nc1 |
| InChI | InChI=1S/C10H15N3OS.C2H6O/c1-15(14)13-7-8-2-3-9(12-6-8)10(11)4-5-10;1-3-2/h2-3,6,13H,4-5,7,11H2,1H3;1-2H3 |
| InChIKey | KGIXQFKWRCXIIZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane?
The IUPAC name of N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane (CID 143812055) is N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane.
What is the SMILES notation for N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane?
The canonical SMILES for N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane is COC.CS(=O)NCc1ccc(C2(N)CC2)nc1.
What is the InChIKey of N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane?
The InChIKey is KGIXQFKWRCXIIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS.C2H6O/c1-15(14)13-7-8-2-3-9(12-6-8)10(11)4-5-10;1-3-2/h2-3,6,13H,4-5,7,11H2,1H3;1-2H3.
What are the key properties of N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane?
N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane has a molecular weight of 271.39 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(1-aminocyclopropyl)-3-pyridinyl]methyl]methanesulfinamide;methoxymethane is sourced from PubChem (CID 143812055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).