methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate

C12H14O2 — CID 14381314

IUPACmethyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate
SMILESCOC(=O)C1Cc2ccccc2C1C
InChIInChI=1S/C12H14O2/c1-8-10-6-4-3-5-9(10)7-11(8)12(13)14-2/h3-6,8,11H,7H2,1-2H3
InChIKeyUZFMKLPKSUPEPO-UHFFFAOYSA-N
MW190.24 g/mol
LogP2.14
Rot. Bonds1

About methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate

methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 14381314) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate.

Molecular Properties

Compound Namemethyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate
PubChem CID14381314
Molecular FormulaC12H14O2
Molecular Weight190.24 g/mol
Exact Mass190.10
IUPAC Namemethyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate
SMILESCOC(=O)C1Cc2ccccc2C1C
InChIInChI=1S/C12H14O2/c1-8-10-6-4-3-5-9(10)7-11(8)12(13)14-2/h3-6,8,11H,7H2,1-2H3
InChIKeyUZFMKLPKSUPEPO-UHFFFAOYSA-N
XLogP2.14
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.24
LogP ≤ 52.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
The IUPAC name of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate (CID 14381314) is methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate.
What is the SMILES notation for methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
The canonical SMILES for methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate is COC(=O)C1Cc2ccccc2C1C.
What is the InChIKey of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
The InChIKey is UZFMKLPKSUPEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-8-10-6-4-3-5-9(10)7-11(8)12(13)14-2/h3-6,8,11H,7H2,1-2H3.
What are the key properties of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate has a molecular weight of 190.24 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate is sourced from PubChem (CID 14381314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).