About methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate
methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 14381314) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate |
| PubChem CID | 14381314 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2C1C |
| InChI | InChI=1S/C12H14O2/c1-8-10-6-4-3-5-9(10)7-11(8)12(13)14-2/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | UZFMKLPKSUPEPO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
The IUPAC name of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate (CID 14381314) is methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate.
What is the SMILES notation for methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
The canonical SMILES for methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate is COC(=O)C1Cc2ccccc2C1C.
What is the InChIKey of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
The InChIKey is UZFMKLPKSUPEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-8-10-6-4-3-5-9(10)7-11(8)12(13)14-2/h3-6,8,11H,7H2,1-2H3.
What are the key properties of methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate?
methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate has a molecular weight of 190.24 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methyl-2,3-dihydro-1H-indene-2-carboxylate is sourced from PubChem (CID 14381314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).