About 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde
4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde (PubChem CID 143813330) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde |
| PubChem CID | 143813330 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)N2CCC3NC(=O)C32)CC1 |
| InChI | InChI=1S/C11H16N4O3/c16-7-13-3-5-14(6-4-13)11(18)15-2-1-8-9(15)10(17)12-8/h7-9H,1-6H2,(H,12,17) |
| InChIKey | RKVXCQFYPWUQCO-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde?
The IUPAC name of 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde (CID 143813330) is 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde.
What is the SMILES notation for 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde?
The canonical SMILES for 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde is O=CN1CCN(C(=O)N2CCC3NC(=O)C32)CC1.
What is the InChIKey of 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde?
The InChIKey is RKVXCQFYPWUQCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c16-7-13-3-5-14(6-4-13)11(18)15-2-1-8-9(15)10(17)12-8/h7-9H,1-6H2,(H,12,17).
What are the key properties of 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde?
4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde has a molecular weight of 252.27 g/mol, XLogP of -1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-oxo-2,6-diazabicyclo[3.2.0]heptane-2-carbonyl)piperazine-1-carbaldehyde is sourced from PubChem (CID 143813330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).