About N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine
N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine (PubChem CID 143813419) has the molecular formula C19H24N4
and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine |
| PubChem CID | 143813419 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine |
| SMILES | C=C/C=C(\C=C)C(C)Nc1cc(-c2cn[nH]c2C(C)C)ccn1 |
| InChI | InChI=1S/C19H24N4/c1-6-8-15(7-2)14(5)22-18-11-16(9-10-20-18)17-12-21-23-19(17)13(3)4/h6-14H,1-2H2,3-5H3,(H,20,22)(H,21,23)/b15-8+ |
| InChIKey | RAPAXFAHOXLAGL-OVCLIPMQSA-N |
| XLogP | 4.69 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine?
The IUPAC name of N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine (CID 143813419) is N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine.
What is the SMILES notation for N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine?
The canonical SMILES for N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine is C=C/C=C(\C=C)C(C)Nc1cc(-c2cn[nH]c2C(C)C)ccn1.
What is the InChIKey of N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine?
The InChIKey is RAPAXFAHOXLAGL-OVCLIPMQSA-N. The full InChI is InChI=1S/C19H24N4/c1-6-8-15(7-2)14(5)22-18-11-16(9-10-20-18)17-12-21-23-19(17)13(3)4/h6-14H,1-2H2,3-5H3,(H,20,22)(H,21,23)/b15-8+.
What are the key properties of N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine?
N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine has a molecular weight of 308.43 g/mol, XLogP of 4.69, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-3-ethenylhexa-3,5-dien-2-yl]-4-(5-propan-2-yl-1H-pyrazol-4-yl)pyridin-2-amine is sourced from PubChem (CID 143813419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).