C21H32 — CID 143813811
2-[(3E,5E,7Z)-5-ethylnona-3,5,7-trien-4-yl]tricyclo[5.2.1.02,6]decane (PubChem CID 143813811) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is 2-[(3E,5E,7Z)-5-ethylnona-3,5,7-trien-4-yl]tricyclo[5.2.1.02,6]decane.
| Compound Name | 2-[(3E,5E,7Z)-5-ethylnona-3,5,7-trien-4-yl]tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 143813811 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 2-[(3E,5E,7Z)-5-ethylnona-3,5,7-trien-4-yl]tricyclo[5.2.1.02,6]decane |
| SMILES | C/C=C\C=C(CC)\C(=C/CC)C12CCCC1C1CCC2C1 |
| InChI | InChI=1S/C21H32/c1-4-7-10-16(6-3)19(9-5-2)21-14-8-11-20(21)17-12-13-18(21)15-17/h4,7,9-10,17-18,20H,5-6,8,11-15H2,1-3H3/b7-4-,16-10+,19-9+ |
| InChIKey | HWBMTVYCSFTPNS-NTJCSLMQSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|