C68H62N2 — CID 143813921
ethane;(3E,5E,7Z)-4-ethyl-5-methylnona-1,3,5,7-tetraene;N-phenyl-N-(4-phenylphenyl)-3-[4-[9-(4-phenylphenyl)carbazol-3-yl]phenyl]aniline (PubChem CID 143813921) has the molecular formula C68H62N2 and a molecular weight of 907.26 g/mol. Its IUPAC name is ethane;(3E,5E,7Z)-4-ethyl-5-methylnona-1,3,5,7-tetraene;N-phenyl-N-(4-phenylphenyl)-3-[4-[9-(4-phenylphenyl)carbazol-3-yl]phenyl]aniline.
| Compound Name | ethane;(3E,5E,7Z)-4-ethyl-5-methylnona-1,3,5,7-tetraene;N-phenyl-N-(4-phenylphenyl)-3-[4-[9-(4-phenylphenyl)carbazol-3-yl]phenyl]aniline |
|---|---|
| PubChem CID | 143813921 |
| Molecular Formula | C68H62N2 |
| Molecular Weight | 907.26 g/mol |
| Exact Mass | 906.49 |
| IUPAC Name | ethane;(3E,5E,7Z)-4-ethyl-5-methylnona-1,3,5,7-tetraene;N-phenyl-N-(4-phenylphenyl)-3-[4-[9-(4-phenylphenyl)carbazol-3-yl]phenyl]aniline |
| SMILES | C=C/C=C(CC)/C(C)=C/C=C\C.CC.c1ccc(-c2ccc(N(c3ccccc3)c3cccc(-c4ccc(-c5ccc6c(c5)c5ccccc5n6-c5ccc(-c6ccccc6)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C54H38N2.C12H18.C2H6/c1-4-13-39(14-5-1)41-27-32-48(33-28-41)55(47-18-8-3-9-19-47)50-20-12-17-45(37-50)43-23-25-44(26-24-43)46-31-36-54-52(38-46)51-21-10-11-22-53(51)56(54)49-34-29-42(30-35-49)40-15-6-2-7-16-40;1-5-8-10-11(4)12(7-3)9-6-2;1-2/h1-38H;5-6,8-10H,2,7H2,1,3-4H3;1-2H3/b;8-5-,11-10+,12-9+; |
| InChIKey | LEBGZZHDGJPJOA-NVVIEHPVSA-N |
| XLogP | 19.98 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.26 |
| LogP ≤ 5 | 19.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|