About 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen
1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen (PubChem CID 143814037) has the molecular formula C8H19NO2
and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen |
| PubChem CID | 143814037 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen |
| SMILES | C.CC(=O)C1CCN(O)CC1.[H][H] |
| InChI | InChI=1S/C7H13NO2.CH4.H2/c1-6(9)7-2-4-8(10)5-3-7;;/h7,10H,2-5H2,1H3;1H4;1H |
| InChIKey | BBMTYAAXARBJRM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen?
The IUPAC name of 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen (CID 143814037) is 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen.
What is the SMILES notation for 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen?
The canonical SMILES for 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen is C.CC(=O)C1CCN(O)CC1.[H][H].
What is the InChIKey of 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen?
The InChIKey is BBMTYAAXARBJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.CH4.H2/c1-6(9)7-2-4-8(10)5-3-7;;/h7,10H,2-5H2,1H3;1H4;1H.
What are the key properties of 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen?
1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen has a molecular weight of 161.25 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxypiperidin-4-yl)ethanone;methane;molecular hydrogen is sourced from PubChem (CID 143814037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).