About (3-pyridin-2-ylphenyl) hypoiodite
(3-pyridin-2-ylphenyl) hypoiodite (PubChem CID 143814721) has the molecular formula C11H8INO
and a molecular weight of 297.10 g/mol. Its IUPAC name is (3-pyridin-2-ylphenyl) hypoiodite.
Molecular Properties
| Compound Name | (3-pyridin-2-ylphenyl) hypoiodite |
| PubChem CID | 143814721 |
| Molecular Formula | C11H8INO |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | (3-pyridin-2-ylphenyl) hypoiodite |
| SMILES | IOc1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C11H8INO/c12-14-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h1-8H |
| InChIKey | ANVRBRYSGMCSGY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-pyridin-2-ylphenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pyridin-2-ylphenyl) hypoiodite?
The IUPAC name of (3-pyridin-2-ylphenyl) hypoiodite (CID 143814721) is (3-pyridin-2-ylphenyl) hypoiodite.
What is the SMILES notation for (3-pyridin-2-ylphenyl) hypoiodite?
The canonical SMILES for (3-pyridin-2-ylphenyl) hypoiodite is IOc1cccc(-c2ccccn2)c1.
What is the InChIKey of (3-pyridin-2-ylphenyl) hypoiodite?
The InChIKey is ANVRBRYSGMCSGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8INO/c12-14-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h1-8H.
What are the key properties of (3-pyridin-2-ylphenyl) hypoiodite?
(3-pyridin-2-ylphenyl) hypoiodite has a molecular weight of 297.10 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pyridin-2-ylphenyl) hypoiodite is sourced from PubChem (CID 143814721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).