C12H20O5 — CID 14381482
ethyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate (PubChem CID 14381482) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate.
| Compound Name | ethyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 14381482 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | ethyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate |
| SMILES | C=C[C@H]([C@H](O)C(=O)OCC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H20O5/c1-5-8(10(13)11(14)15-6-2)9-7-16-12(3,4)17-9/h5,8-10,13H,1,6-7H2,2-4H3/t8-,9+,10-/m0/s1 |
| InChIKey | WHDIVLSRXFASIC-AEJSXWLSSA-N |
| XLogP | 0.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|