About 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one
4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 14381503) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 14381503 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC1Cc2c(N)ncnc2NC1=O |
| InChI | InChI=1S/C8H10N4O/c1-4-2-5-6(9)10-3-11-7(5)12-8(4)13/h3-4H,2H2,1H3,(H3,9,10,11,12,13) |
| InChIKey | JHYWCDVSZGXYGC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (CID 14381503) is 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one is CC1Cc2c(N)ncnc2NC1=O.
What is the InChIKey of 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is JHYWCDVSZGXYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-4-2-5-6(9)10-3-11-7(5)12-8(4)13/h3-4H,2H2,1H3,(H3,9,10,11,12,13).
What are the key properties of 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one?
4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 178.19 g/mol, XLogP of 0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 14381503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).