C29H40O6 — CID 143815034
(2E,4E,6E,8E)-10-[[(3R,4S,5S,6R)-4-[(2R,3S)-3-cyclopropyl-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid (PubChem CID 143815034) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is (2E,4E,6E,8E)-10-[[(3R,4S,5S,6R)-4-[(2R,3S)-3-cyclopropyl-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-10-[[(3R,4S,5S,6R)-4-[(2R,3S)-3-cyclopropyl-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 143815034 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | (2E,4E,6E,8E)-10-[[(3R,4S,5S,6R)-4-[(2R,3S)-3-cyclopropyl-6-methylhept-5-en-2-yl]-5-methoxy-1-oxaspiro[2.5]octan-6-yl]oxy]-10-oxodeca-2,4,6,8-tetraenoic acid |
| SMILES | CO[C@H]1[C@H]([C@H](C)[C@@H](CC=C(C)C)C2CC2)[C@]2(CC[C@H]1OC(=O)/C=C/C=C/C=C/C=C/C(=O)O)CO2 |
| InChI | InChI=1S/C29H40O6/c1-20(2)13-16-23(22-14-15-22)21(3)27-28(33-4)24(17-18-29(27)19-34-29)35-26(32)12-10-8-6-5-7-9-11-25(30)31/h5-13,21-24,27-28H,14-19H2,1-4H3,(H,30,31)/b7-5+,8-6+,11-9+,12-10+/t21-,23-,24-,27+,28-,29+/m1/s1 |
| InChIKey | PHQXPVVYWNHPRA-HTHFKVCOSA-N |
| XLogP | 5.42 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|