C34H37N9O2 — CID 143815086
2-[(3S)-3-[[(3-pyridin-4-yl-1H-indazol-5-yl)amino]methoxymethyl]pyrrolidin-1-yl]-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone (PubChem CID 143815086) has the molecular formula C34H37N9O2 and a molecular weight of 603.73 g/mol. Its IUPAC name is 2-[(3S)-3-[[(3-pyridin-4-yl-1H-indazol-5-yl)amino]methoxymethyl]pyrrolidin-1-yl]-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3S)-3-[[(3-pyridin-4-yl-1H-indazol-5-yl)amino]methoxymethyl]pyrrolidin-1-yl]-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143815086 |
| Molecular Formula | C34H37N9O2 |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | 2-[(3S)-3-[[(3-pyridin-4-yl-1H-indazol-5-yl)amino]methoxymethyl]pyrrolidin-1-yl]-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CC[C@H](COCNc2ccc3[nH]nc(-c4ccncc4)c3c2)C1)N1CCN(c2ccc(-c3ncccn3)cc2)CC1 |
| InChI | InChI=1S/C34H37N9O2/c44-32(43-18-16-42(17-19-43)29-5-2-27(3-6-29)34-36-11-1-12-37-34)22-41-15-10-25(21-41)23-45-24-38-28-4-7-31-30(20-28)33(40-39-31)26-8-13-35-14-9-26/h1-9,11-14,20,25,38H,10,15-19,21-24H2,(H,39,40)/t25-/m0/s1 |
| InChIKey | VIKGFORLVLDPGW-VWLOTQADSA-N |
| XLogP | 4.14 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|