About ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole
ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole (PubChem CID 143815298) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole |
| PubChem CID | 143815298 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole |
| SMILES | C=CCC1Nc2ccccc2C1(C)CCC.C=CO |
| InChI | InChI=1S/C15H21N.C2H4O/c1-4-8-14-15(3,11-5-2)12-9-6-7-10-13(12)16-14;1-2-3/h4,6-7,9-10,14,16H,1,5,8,11H2,2-3H3;2-3H,1H2 |
| InChIKey | NFAMTOMCBFRLRZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole?
The IUPAC name of ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole (CID 143815298) is ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole.
What is the SMILES notation for ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole?
The canonical SMILES for ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole is C=CCC1Nc2ccccc2C1(C)CCC.C=CO.
What is the InChIKey of ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole?
The InChIKey is NFAMTOMCBFRLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N.C2H4O/c1-4-8-14-15(3,11-5-2)12-9-6-7-10-13(12)16-14;1-2-3/h4,6-7,9-10,14,16H,1,5,8,11H2,2-3H3;2-3H,1H2.
What are the key properties of ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole?
ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole has a molecular weight of 259.39 g/mol, XLogP of 4.80, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;3-methyl-2-prop-2-enyl-3-propyl-1,2-dihydroindole is sourced from PubChem (CID 143815298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).