C9H14N2 — CID 143815335
7-methylidene-2,3,4,5,8,9-hexahydropyrrolo[1,2-a][1,3]diazepine (PubChem CID 143815335) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 7-methylidene-2,3,4,5,8,9-hexahydropyrrolo[1,2-a][1,3]diazepine.
| Compound Name | 7-methylidene-2,3,4,5,8,9-hexahydropyrrolo[1,2-a][1,3]diazepine |
|---|---|
| PubChem CID | 143815335 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 7-methylidene-2,3,4,5,8,9-hexahydropyrrolo[1,2-a][1,3]diazepine |
| SMILES | C=C1CCC2=NCCCCN12 |
| InChI | InChI=1S/C9H14N2/c1-8-4-5-9-10-6-2-3-7-11(8)9/h1-7H2 |
| InChIKey | LTADUMOVAHELLP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |