C14H23NO2 — CID 143815373
4-[(4E)-4-ethenyl-3-methoxyhepta-4,6-dienyl]morpholine (PubChem CID 143815373) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-[(4E)-4-ethenyl-3-methoxyhepta-4,6-dienyl]morpholine.
| Compound Name | 4-[(4E)-4-ethenyl-3-methoxyhepta-4,6-dienyl]morpholine |
|---|---|
| PubChem CID | 143815373 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-[(4E)-4-ethenyl-3-methoxyhepta-4,6-dienyl]morpholine |
| SMILES | C=C/C=C(\C=C)C(CCN1CCOCC1)OC |
| InChI | InChI=1S/C14H23NO2/c1-4-6-13(5-2)14(16-3)7-8-15-9-11-17-12-10-15/h4-6,14H,1-2,7-12H2,3H3/b13-6+ |
| InChIKey | MWRLAWHBPLNIKL-AWNIVKPZSA-N |
| XLogP | 2.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|