About 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol
1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol (PubChem CID 143815376) has the molecular formula C14H17NOS
and a molecular weight of 247.36 g/mol. Its IUPAC name is 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol.
Molecular Properties
| Compound Name | 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol |
| PubChem CID | 143815376 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol |
| SMILES | C=C(O)C1CC2(CS1)CN(C)c1ccccc12 |
| InChI | InChI=1S/C14H17NOS/c1-10(16)13-7-14(9-17-13)8-15(2)12-6-4-3-5-11(12)14/h3-6,13,16H,1,7-9H2,2H3 |
| InChIKey | PEZLRZGXAQNRMP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol?
The IUPAC name of 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol (CID 143815376) is 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol.
What is the SMILES notation for 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol?
The canonical SMILES for 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol is C=C(O)C1CC2(CS1)CN(C)c1ccccc12.
What is the InChIKey of 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol?
The InChIKey is PEZLRZGXAQNRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NOS/c1-10(16)13-7-14(9-17-13)8-15(2)12-6-4-3-5-11(12)14/h3-6,13,16H,1,7-9H2,2H3.
What are the key properties of 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol?
1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol has a molecular weight of 247.36 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylspiro[2H-indole-3,4'-thiolane]-2'-yl)ethenol is sourced from PubChem (CID 143815376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).