About ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine
ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine (PubChem CID 143815645) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine.
Molecular Properties
| Compound Name | ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine |
| PubChem CID | 143815645 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine |
| SMILES | CC.CCc1c(C)ccnc1N(C)C |
| InChI | InChI=1S/C10H16N2.C2H6/c1-5-9-8(2)6-7-11-10(9)12(3)4;1-2/h6-7H,5H2,1-4H3;1-2H3 |
| InChIKey | NRHREOGRAKAJKC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine?
The IUPAC name of ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine (CID 143815645) is ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine.
What is the SMILES notation for ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine?
The canonical SMILES for ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine is CC.CCc1c(C)ccnc1N(C)C.
What is the InChIKey of ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine?
The InChIKey is NRHREOGRAKAJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.C2H6/c1-5-9-8(2)6-7-11-10(9)12(3)4;1-2/h6-7H,5H2,1-4H3;1-2H3.
What are the key properties of ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine?
ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine has a molecular weight of 194.32 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-N,N,4-trimethylpyridin-2-amine is sourced from PubChem (CID 143815645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).