C14H15BrFNO — CID 143815672
2-bromo-N-[(1Z)-buta-1,3-dienyl]-N-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]acetamide (PubChem CID 143815672) has the molecular formula C14H15BrFNO and a molecular weight of 312.18 g/mol. Its IUPAC name is 2-bromo-N-[(1Z)-buta-1,3-dienyl]-N-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]acetamide.
| Compound Name | 2-bromo-N-[(1Z)-buta-1,3-dienyl]-N-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]acetamide |
|---|---|
| PubChem CID | 143815672 |
| Molecular Formula | C14H15BrFNO |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-bromo-N-[(1Z)-buta-1,3-dienyl]-N-[(4-fluorocyclohepta-2,4,6-trien-1-yl)methyl]acetamide |
| SMILES | C=C/C=C\N(CC1C=CC=C(F)C=C1)C(=O)CBr |
| InChI | InChI=1S/C14H15BrFNO/c1-2-3-9-17(14(18)10-15)11-12-5-4-6-13(16)8-7-12/h2-9,12H,1,10-11H2/b9-3- |
| InChIKey | RHMAVSSKDNBQCV-OQFOIZHKSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|