About (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine
(3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine (PubChem CID 143815676) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine.
Molecular Properties
| Compound Name | (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine |
| PubChem CID | 143815676 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine |
| SMILES | [H]/N=C(\C/C=C/CCC=C)c1nccn1C=C |
| InChI | InChI=1S/C13H17N3/c1-3-5-6-7-8-9-12(14)13-15-10-11-16(13)4-2/h3-4,7-8,10-11,14H,1-2,5-6,9H2/b8-7+,14-12+ |
| InChIKey | SDYJLTWMUICNIO-DZSZGWLZSA-N |
| XLogP | 3.26 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine?
The IUPAC name of (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine (CID 143815676) is (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine.
What is the SMILES notation for (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine?
The canonical SMILES for (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine is [H]/N=C(\C/C=C/CCC=C)c1nccn1C=C.
What is the InChIKey of (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine?
The InChIKey is SDYJLTWMUICNIO-DZSZGWLZSA-N. The full InChI is InChI=1S/C13H17N3/c1-3-5-6-7-8-9-12(14)13-15-10-11-16(13)4-2/h3-4,7-8,10-11,14H,1-2,5-6,9H2/b8-7+,14-12+.
What are the key properties of (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine?
(3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine has a molecular weight of 215.30 g/mol, XLogP of 3.26, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-(1-ethenylimidazol-2-yl)octa-3,7-dien-1-imine is sourced from PubChem (CID 143815676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).