About 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine
5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine (PubChem CID 143815729) has the molecular formula C13H14N2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine.
Molecular Properties
| Compound Name | 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine |
| PubChem CID | 143815729 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine |
| SMILES | C=CC1=C(N(C)C)C(=C)c2ncccc21 |
| InChI | InChI=1S/C13H14N2/c1-5-10-11-7-6-8-14-12(11)9(2)13(10)15(3)4/h5-8H,1-2H2,3-4H3 |
| InChIKey | CVJRQJULCIKWPN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine?
The IUPAC name of 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine (CID 143815729) is 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine.
What is the SMILES notation for 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine?
The canonical SMILES for 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine is C=CC1=C(N(C)C)C(=C)c2ncccc21.
What is the InChIKey of 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine?
The InChIKey is CVJRQJULCIKWPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2/c1-5-10-11-7-6-8-14-12(11)9(2)13(10)15(3)4/h5-8H,1-2H2,3-4H3.
What are the key properties of 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine?
5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine has a molecular weight of 198.27 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-N,N-dimethyl-7-methylidenecyclopenta[b]pyridin-6-amine is sourced from PubChem (CID 143815729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).