C10H17NO4 — CID 143816400
2-amino-7-(methoxymethyl)-5,5,7-trimethyl-1,6-dioxaspiro[2.4]heptan-4-one (PubChem CID 143816400) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-amino-7-(methoxymethyl)-5,5,7-trimethyl-1,6-dioxaspiro[2.4]heptan-4-one.
| Compound Name | 2-amino-7-(methoxymethyl)-5,5,7-trimethyl-1,6-dioxaspiro[2.4]heptan-4-one |
|---|---|
| PubChem CID | 143816400 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-amino-7-(methoxymethyl)-5,5,7-trimethyl-1,6-dioxaspiro[2.4]heptan-4-one |
| SMILES | COCC1(C)OC(C)(C)C(=O)C12OC2N |
| InChI | InChI=1S/C10H17NO4/c1-8(2)6(12)10(7(11)14-10)9(3,15-8)5-13-4/h7H,5,11H2,1-4H3 |
| InChIKey | BMYNHHWGDPSXGD-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|