C22H25N — CID 143817180
ethane;N,N,2-trimethyltetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),3,5,7,9(17),10,12(16),13-octaen-2-amine (PubChem CID 143817180) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is ethane;N,N,2-trimethyltetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),3,5,7,9(17),10,12(16),13-octaen-2-amine.
| Compound Name | ethane;N,N,2-trimethyltetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),3,5,7,9(17),10,12(16),13-octaen-2-amine |
|---|---|
| PubChem CID | 143817180 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | ethane;N,N,2-trimethyltetracyclo[7.6.2.05,17.012,16]heptadeca-1(15),3,5,7,9(17),10,12(16),13-octaen-2-amine |
| SMILES | CC.CN(C)C1(C)C=Cc2cccc3ccc4cccc1c4c23 |
| InChI | InChI=1S/C20H19N.C2H6/c1-20(21(2)3)13-12-16-7-4-6-14-10-11-15-8-5-9-17(20)19(15)18(14)16;1-2/h4-13H,1-3H3;1-2H3 |
| InChIKey | GZELINACMWZULA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|