C9H16OS — CID 143817231
(4E,5E)-4,5-di(ethylidene)-1,3-oxathiolane;ethane (PubChem CID 143817231) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1,3-oxathiolane;ethane.
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1,3-oxathiolane;ethane |
|---|---|
| PubChem CID | 143817231 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1,3-oxathiolane;ethane |
| SMILES | C/C=C1/OCS/C1=C/C.CC |
| InChI | InChI=1S/C7H10OS.C2H6/c1-3-6-7(4-2)9-5-8-6;1-2/h3-4H,5H2,1-2H3;1-2H3/b6-3+,7-4+; |
| InChIKey | UKOYQJOTTMCAJR-BTQXJGEMSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |