C27H28FN3OS — CID 143817661
N-(azepan-1-yl)-9-(4-fluorophenyl)-2-thia-10-azatetracyclo[9.5.0.03,8.014,16]hexadeca-1(11),3,5,7,9,12-hexaene-13-carboxamide;molecular hydrogen (PubChem CID 143817661) has the molecular formula C27H28FN3OS and a molecular weight of 461.61 g/mol. Its IUPAC name is N-(azepan-1-yl)-9-(4-fluorophenyl)-2-thia-10-azatetracyclo[9.5.0.03,8.014,16]hexadeca-1(11),3,5,7,9,12-hexaene-13-carboxamide;molecular hydrogen.
| Compound Name | N-(azepan-1-yl)-9-(4-fluorophenyl)-2-thia-10-azatetracyclo[9.5.0.03,8.014,16]hexadeca-1(11),3,5,7,9,12-hexaene-13-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 143817661 |
| Molecular Formula | C27H28FN3OS |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-(azepan-1-yl)-9-(4-fluorophenyl)-2-thia-10-azatetracyclo[9.5.0.03,8.014,16]hexadeca-1(11),3,5,7,9,12-hexaene-13-carboxamide;molecular hydrogen |
| SMILES | O=C(NN1CCCCCC1)C1=CC2=C(Sc3ccccc3C(c3ccc(F)cc3)=N2)C2CC12.[H][H] |
| InChI | InChI=1S/C27H26FN3OS.H2/c28-18-11-9-17(10-12-18)25-19-7-3-4-8-24(19)33-26-21-15-20(21)22(16-23(26)29-25)27(32)30-31-13-5-1-2-6-14-31;/h3-4,7-12,16,20-21H,1-2,5-6,13-15H2,(H,30,32);1H |
| InChIKey | VQFATDDNYONORY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |