C15H14F6O2 — CID 143817709
2-methylpent-2-enyl 2,6-bis(trifluoromethyl)benzoate (PubChem CID 143817709) has the molecular formula C15H14F6O2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 2-methylpent-2-enyl 2,6-bis(trifluoromethyl)benzoate.
| Compound Name | 2-methylpent-2-enyl 2,6-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 143817709 |
| Molecular Formula | C15H14F6O2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-methylpent-2-enyl 2,6-bis(trifluoromethyl)benzoate |
| SMILES | CCC=C(C)COC(=O)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C15H14F6O2/c1-3-5-9(2)8-23-13(22)12-10(14(16,17)18)6-4-7-11(12)15(19,20)21/h4-7H,3,8H2,1-2H3 |
| InChIKey | DARZVLAVFKMKJR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|