C29H36F4N4OS — CID 143817787
N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine;propane (PubChem CID 143817787) has the molecular formula C29H36F4N4OS and a molecular weight of 564.69 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine;propane.
| Compound Name | N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine;propane |
|---|---|
| PubChem CID | 143817787 |
| Molecular Formula | C29H36F4N4OS |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine;propane |
| SMILES | C=C(COc1c(F)c(F)cc(F)c1F)C(CCCC)n1cc(C(C)NCc2ccc3ncsc3c2)[nH]1.CCC |
| InChI | InChI=1S/C26H28F4N4OS.C3H8/c1-4-5-6-22(15(2)13-35-26-24(29)18(27)10-19(28)25(26)30)34-12-21(33-34)16(3)31-11-17-7-8-20-23(9-17)36-14-32-20;1-3-2/h7-10,12,14,16,22,31,33H,2,4-6,11,13H2,1,3H3;3H2,1-2H3 |
| InChIKey | OBDPKGZVLBUNNU-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|