C26H28F4N4OS — CID 143817788
N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine (PubChem CID 143817788) has the molecular formula C26H28F4N4OS and a molecular weight of 520.60 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine.
| Compound Name | N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine |
|---|---|
| PubChem CID | 143817788 |
| Molecular Formula | C26H28F4N4OS |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-(1,3-benzothiazol-6-ylmethyl)-1-[2-[2-[(2,3,5,6-tetrafluorophenoxy)methyl]hept-1-en-3-yl]-1H-diazet-4-yl]ethanamine |
| SMILES | C=C(COc1c(F)c(F)cc(F)c1F)C(CCCC)n1cc(C(C)NCc2ccc3ncsc3c2)[nH]1 |
| InChI | InChI=1S/C26H28F4N4OS/c1-4-5-6-22(15(2)13-35-26-24(29)18(27)10-19(28)25(26)30)34-12-21(33-34)16(3)31-11-17-7-8-20-23(9-17)36-14-32-20/h7-10,12,14,16,22,31,33H,2,4-6,11,13H2,1,3H3 |
| InChIKey | SHWTXTYECUIODO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|