C19H21NO4S — CID 1438179
[1-(benzenesulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 1438179) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 1438179 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-24-17-9-7-15(8-10-17)19(21)16-11-13-20(14-12-16)25(22,23)18-5-3-2-4-6-18/h2-10,16H,11-14H2,1H3 |
| InChIKey | NATAMIBGUQNVMU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |