About ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole
ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole (PubChem CID 143818471) has the molecular formula C15H23F3N2O
and a molecular weight of 304.36 g/mol. Its IUPAC name is ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole.
Molecular Properties
| Compound Name | ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole |
| PubChem CID | 143818471 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole |
| SMILES | CC.CC(/C=C\C(C)n1cnc(C)c1)=C/COC(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O.C2H6/c1-10(6-7-19-13(14,15)16)4-5-12(3)18-8-11(2)17-9-18;1-2/h4-6,8-9,12H,7H2,1-3H3;1-2H3/b5-4-,10-6-; |
| InChIKey | SKRMKAZLYLSJMP-ICHDRJDBSA-N |
| XLogP | 4.82 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
The IUPAC name of ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole (CID 143818471) is ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole.
What is the SMILES notation for ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
The canonical SMILES for ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole is CC.CC(/C=C\C(C)n1cnc(C)c1)=C/COC(F)(F)F.
What is the InChIKey of ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
The InChIKey is SKRMKAZLYLSJMP-ICHDRJDBSA-N. The full InChI is InChI=1S/C13H17F3N2O.C2H6/c1-10(6-7-19-13(14,15)16)4-5-12(3)18-8-11(2)17-9-18;1-2/h4-6,8-9,12H,7H2,1-3H3;1-2H3/b5-4-,10-6-;.
What are the key properties of ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole has a molecular weight of 304.36 g/mol, XLogP of 4.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole is sourced from PubChem (CID 143818471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).