About 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole
4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole (PubChem CID 143818472) has the molecular formula C13H17F3N2O
and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole.
Molecular Properties
| Compound Name | 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole |
| PubChem CID | 143818472 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole |
| SMILES | CC(/C=C\C(C)n1cnc(C)c1)=C/COC(F)(F)F |
| InChI | InChI=1S/C13H17F3N2O/c1-10(6-7-19-13(14,15)16)4-5-12(3)18-8-11(2)17-9-18/h4-6,8-9,12H,7H2,1-3H3/b5-4-,10-6- |
| InChIKey | BIVBPONWXHXMPO-ARSRRCBKSA-N |
| XLogP | 3.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
The IUPAC name of 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole (CID 143818472) is 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole.
What is the SMILES notation for 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
The canonical SMILES for 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole is CC(/C=C\C(C)n1cnc(C)c1)=C/COC(F)(F)F.
What is the InChIKey of 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
The InChIKey is BIVBPONWXHXMPO-ARSRRCBKSA-N. The full InChI is InChI=1S/C13H17F3N2O/c1-10(6-7-19-13(14,15)16)4-5-12(3)18-8-11(2)17-9-18/h4-6,8-9,12H,7H2,1-3H3/b5-4-,10-6-.
What are the key properties of 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole?
4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole has a molecular weight of 274.29 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[(3Z,5Z)-5-methyl-7-(trifluoromethoxy)hepta-3,5-dien-2-yl]imidazole is sourced from PubChem (CID 143818472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).