About 5-fluoro-3-methyl-2,3-dihydropyridine
5-fluoro-3-methyl-2,3-dihydropyridine (PubChem CID 143818517) has the molecular formula C6H8FN
and a molecular weight of 113.13 g/mol. Its IUPAC name is 5-fluoro-3-methyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 5-fluoro-3-methyl-2,3-dihydropyridine |
| PubChem CID | 143818517 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 5-fluoro-3-methyl-2,3-dihydropyridine |
| SMILES | CC1C=C(F)C=NC1 |
| InChI | InChI=1S/C6H8FN/c1-5-2-6(7)4-8-3-5/h2,4-5H,3H2,1H3 |
| InChIKey | AEPGLGYAHUZXOM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-3-methyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methyl-2,3-dihydropyridine?
The IUPAC name of 5-fluoro-3-methyl-2,3-dihydropyridine (CID 143818517) is 5-fluoro-3-methyl-2,3-dihydropyridine.
What is the SMILES notation for 5-fluoro-3-methyl-2,3-dihydropyridine?
The canonical SMILES for 5-fluoro-3-methyl-2,3-dihydropyridine is CC1C=C(F)C=NC1.
What is the InChIKey of 5-fluoro-3-methyl-2,3-dihydropyridine?
The InChIKey is AEPGLGYAHUZXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FN/c1-5-2-6(7)4-8-3-5/h2,4-5H,3H2,1H3.
What are the key properties of 5-fluoro-3-methyl-2,3-dihydropyridine?
5-fluoro-3-methyl-2,3-dihydropyridine has a molecular weight of 113.13 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methyl-2,3-dihydropyridine is sourced from PubChem (CID 143818517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).