About 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one
6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one (PubChem CID 14381890) has the molecular formula C16H12N2O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one.
Molecular Properties
| Compound Name | 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one |
| PubChem CID | 14381890 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one |
| SMILES | O=C1c2ccccc2C2=NCc3ccccc3CN12 |
| InChI | InChI=1S/C16H12N2O/c19-16-14-8-4-3-7-13(14)15-17-9-11-5-1-2-6-12(11)10-18(15)16/h1-8H,9-10H2 |
| InChIKey | DNZWCXNBOOTAHT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one?
The IUPAC name of 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one (CID 14381890) is 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one.
What is the SMILES notation for 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one?
The canonical SMILES for 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one is O=C1c2ccccc2C2=NCc3ccccc3CN12.
What is the InChIKey of 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one?
The InChIKey is DNZWCXNBOOTAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O/c19-16-14-8-4-3-7-13(14)15-17-9-11-5-1-2-6-12(11)10-18(15)16/h1-8H,9-10H2.
What are the key properties of 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one?
6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one has a molecular weight of 248.29 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dihydroisoindolo[2,3-b][2,4]benzodiazepin-13-one is sourced from PubChem (CID 14381890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).