C33H49N3O2 — CID 143818912
[(4E,6Z,7Z)-8-cyano-7-[2,4-dimethyl-3-[(Z)-prop-1-enyl]anilino]-6-ethylidenedeca-4,7,9-trienyl] N,N-dipropylcarbamate;ethane (PubChem CID 143818912) has the molecular formula C33H49N3O2 and a molecular weight of 519.77 g/mol. Its IUPAC name is [(4E,6Z,7Z)-8-cyano-7-[2,4-dimethyl-3-[(Z)-prop-1-enyl]anilino]-6-ethylidenedeca-4,7,9-trienyl] N,N-dipropylcarbamate;ethane.
| Compound Name | [(4E,6Z,7Z)-8-cyano-7-[2,4-dimethyl-3-[(Z)-prop-1-enyl]anilino]-6-ethylidenedeca-4,7,9-trienyl] N,N-dipropylcarbamate;ethane |
|---|---|
| PubChem CID | 143818912 |
| Molecular Formula | C33H49N3O2 |
| Molecular Weight | 519.77 g/mol |
| Exact Mass | 519.38 |
| IUPAC Name | [(4E,6Z,7Z)-8-cyano-7-[2,4-dimethyl-3-[(Z)-prop-1-enyl]anilino]-6-ethylidenedeca-4,7,9-trienyl] N,N-dipropylcarbamate;ethane |
| SMILES | C=C/C(C#N)=C(Nc1ccc(C)c(/C=C\C)c1C)\C(=C/C)\C=C\CCCOC(=O)N(CCC)CCC.CC |
| InChI | InChI=1S/C31H43N3O2.C2H6/c1-8-16-28-24(6)18-19-29(25(28)7)33-30(27(12-5)23-32)26(11-4)17-14-13-15-22-36-31(35)34(20-9-2)21-10-3;1-2/h8,11-12,14,16-19,33H,5,9-10,13,15,20-22H2,1-4,6-7H3;1-2H3/b16-8-,17-14+,26-11-,30-27-; |
| InChIKey | NKKNAYLPOXREPA-SIWJJADASA-N |
| XLogP | 9.28 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.77 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|