About ethane;1-ethenoxyethanol
ethane;1-ethenoxyethanol (PubChem CID 143819454) has the molecular formula C6H14O2
and a molecular weight of 118.18 g/mol. Its IUPAC name is ethane;1-ethenoxyethanol.
Molecular Properties
| Compound Name | ethane;1-ethenoxyethanol |
| PubChem CID | 143819454 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | ethane;1-ethenoxyethanol |
| SMILES | C=COC(C)O.CC |
| InChI | InChI=1S/C4H8O2.C2H6/c1-3-6-4(2)5;1-2/h3-5H,1H2,2H3;1-2H3 |
| InChIKey | IMIVQYHURZKOOH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethenoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenoxyethanol?
The IUPAC name of ethane;1-ethenoxyethanol (CID 143819454) is ethane;1-ethenoxyethanol.
What is the SMILES notation for ethane;1-ethenoxyethanol?
The canonical SMILES for ethane;1-ethenoxyethanol is C=COC(C)O.CC.
What is the InChIKey of ethane;1-ethenoxyethanol?
The InChIKey is IMIVQYHURZKOOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C2H6/c1-3-6-4(2)5;1-2/h3-5H,1H2,2H3;1-2H3.
What are the key properties of ethane;1-ethenoxyethanol?
ethane;1-ethenoxyethanol has a molecular weight of 118.18 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenoxyethanol is sourced from PubChem (CID 143819454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).