About diphenylarsorylbenzene
diphenylarsorylbenzene (PubChem CID 14382) has the molecular formula C18H15AsO
and a molecular weight of 322.24 g/mol. Its IUPAC name is diphenylarsorylbenzene.
Molecular Properties
| Compound Name | diphenylarsorylbenzene |
| PubChem CID | 14382 |
| Molecular Formula | C18H15AsO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | diphenylarsorylbenzene |
| SMILES | O=[As](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15AsO/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | CLVJBRYGLQNRDA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diphenylarsorylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylarsorylbenzene?
The IUPAC name of diphenylarsorylbenzene (CID 14382) is diphenylarsorylbenzene.
What is the SMILES notation for diphenylarsorylbenzene?
The canonical SMILES for diphenylarsorylbenzene is O=[As](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylarsorylbenzene?
The InChIKey is CLVJBRYGLQNRDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15AsO/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H.
What are the key properties of diphenylarsorylbenzene?
diphenylarsorylbenzene has a molecular weight of 322.24 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylarsorylbenzene is sourced from PubChem (CID 14382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).