About ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate
ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate (PubChem CID 143820417) has the molecular formula C9H13ClO2
and a molecular weight of 188.65 g/mol. Its IUPAC name is ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate.
Molecular Properties
| Compound Name | ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate |
| PubChem CID | 143820417 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate |
| SMILES | C=C.C=C/C(=C\C)COC(=O)Cl |
| InChI | InChI=1S/C7H9ClO2.C2H4/c1-3-6(4-2)5-10-7(8)9;1-2/h3-4H,1,5H2,2H3;1-2H2/b6-4+; |
| InChIKey | YTMOHGIAUFJVPQ-CVDVRWGVSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate?
The IUPAC name of ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate (CID 143820417) is ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate.
What is the SMILES notation for ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate?
The canonical SMILES for ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate is C=C.C=C/C(=C\C)COC(=O)Cl.
What is the InChIKey of ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate?
The InChIKey is YTMOHGIAUFJVPQ-CVDVRWGVSA-N. The full InChI is InChI=1S/C7H9ClO2.C2H4/c1-3-6(4-2)5-10-7(8)9;1-2/h3-4H,1,5H2,2H3;1-2H2/b6-4+;.
What are the key properties of ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate?
ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate has a molecular weight of 188.65 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;[(E)-2-ethenylbut-2-enyl] carbonochloridate is sourced from PubChem (CID 143820417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).