C32H37ClF3N3O3 — CID 143820537
2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-[(2E)-2-ethenylpenta-2,4-dienoxy]phenyl]piperazin-1-yl]ethanone (PubChem CID 143820537) has the molecular formula C32H37ClF3N3O3 and a molecular weight of 604.11 g/mol. Its IUPAC name is 2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-[(2E)-2-ethenylpenta-2,4-dienoxy]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-[(2E)-2-ethenylpenta-2,4-dienoxy]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143820537 |
| Molecular Formula | C32H37ClF3N3O3 |
| Molecular Weight | 604.11 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 2-[4-[4-chloro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-[(2E)-2-ethenylpenta-2,4-dienoxy]phenyl]piperazin-1-yl]ethanone |
| SMILES | C=C/C=C(\C=C)COc1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(Cl)c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C32H37ClF3N3O3/c1-3-5-23(4-2)21-41-28-13-9-26(10-14-28)38-16-18-39(19-17-38)31(40)22-42-27-11-6-24(7-12-27)37-25-8-15-30(33)29(20-25)32(34,35)36/h3-5,8-10,13-15,20,24,27,37H,1-2,6-7,11-12,16-19,21-22H2/b23-5+ |
| InChIKey | ZCPJDKFMEKCPRV-MUDSWDHVSA-N |
| XLogP | 7.12 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.11 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|