C27H35F3N4O4 — CID 143820554
2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 143820554) has the molecular formula C27H35F3N4O4 and a molecular weight of 536.60 g/mol. Its IUPAC name is 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143820554 |
| Molecular Formula | C27H35F3N4O4 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2-[4-[4-amino-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(N)c(C(F)(F)F)c4)CC3)CC2)cc1OC |
| InChI | InChI=1S/C27H35F3N4O4/c1-36-24-10-6-20(16-25(24)37-2)33-11-13-34(14-12-33)26(35)17-38-21-7-3-18(4-8-21)32-19-5-9-23(31)22(15-19)27(28,29)30/h5-6,9-10,15-16,18,21,32H,3-4,7-8,11-14,17,31H2,1-2H3 |
| InChIKey | RYNCKXVOLWFJKD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|